Today is 2026-04-22 Wednesday,Welcome to this site 

Industry News

How Solubilizer to 15 S Can Improve the Solubility and Performance of Various Chemicals

Word:[Big][Middle][Small] 2023-4-23     Viewed:    
Solubilizer to 15 S is a type of surfactant that can dissolve or disperse various chemicals in water or other solvents. Solubilizer to 15 S is also known as lauryl alcohol polyoxyethylene (15) ether ammonium sulfate salt, and has the chemical formula C12H25(OCH2CH2)15OSO3NH4. Solubilizer to 15 S belongs to the class of anionic surfactants, which means that it has a negatively charged group in its molecular structure.

Solubilizer to 15 S has many applications in different fields such as electroplating, metal cleaning, emulsion polymerization, oil exploitation, and water treatment. Solubilizer to 15 S can improve the solubility and performance of various chemicals by providing the following functions:
  • Solubilization: Solubilizer to 15 S can increase the solubility of poorly soluble or insoluble chemicals in water or other solvents by forming micelles or complexes with them. For example, Solubilizer to 15 S can be used as a solvent for electroplating brightener (benzylidene acetone), which can improve the brightness and uniformity of the metal surface.
  • Washing: Solubilizer to 15 S can enhance the washing effect of detergents or cleaners by reducing the surface tension and increasing the wetting ability of water or other solvents. For example, Solubilizer to 15 S can be used as a metal cleaning agent, which can remove dirt, grease, rust, and scale from metal surfaces.
  • Emulsification: Solubilizer to 15 S can stabilize the dispersion of two immiscible liquids by forming a thin film around the droplets of one liquid in another liquid. For example, Solubilizer to 15 S can be used as an emulsifier in emulsion polymerization, which can produce uniform and stable polymer particles.
  • Dispersion: Solubilizer to 15 S can prevent the aggregation or sedimentation of solid particles in a liquid by forming a protective layer around them. For example, Solubilizer to 15 S can be used as a dispersant in oil exploitation, which can improve the recovery rate of crude oil by preventing the formation of oil sludge.
  • Chelation: Solubilizer to 15 S can bind with metal ions and form soluble complexes that can prevent the precipitation or corrosion of metals. For example, Solubilizer to 15 S can be used as a chelating agent in water treatment, which can reduce the water hardness and metal ion residue that can interfere with the water quality.
Therefore, Solubilizer to 15 S is an effective and versatile surfactant that can improve the solubility and performance of various chemicals in different fields. Solubilizer to 15 S can provide multiple benefits to chemical manufacturers, users, and environment by improving the quality, efficiency, functionality, and sustainability of chemical products.
Go Back
Print
86 21 64057580
Browse mobile station